CAS 887568-69-6

6-Bromo-3-iodo-4-methoxy-1H-indazole

Description:

6-Bromo-3-iodo-4-methoxy-1H-indazole is a chemical compound characterized by its unique indazole structure, which consists of a five-membered ring fused to a six-membered ring. This compound features a bromine atom at the 6-position and an iodine atom at the 3-position, contributing to its halogenated nature, which can influence its reactivity and biological activity. The presence of a methoxy group (-OCH3) at the 4-position enhances its solubility and may affect its interaction with biological targets. This compound is of interest in medicinal chemistry and pharmacology due to its potential applications in drug development, particularly in the field of cancer research and other therapeutic areas. Its molecular properties, such as polarity and stability, are influenced by the halogen substituents and the methoxy group, making it a subject of study for its synthetic pathways and biological effects. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₈H₆BrIN₂O

InChI: InChI=1S/C8H6BrIN2O/c1-13-6-3-4(9)2-5-7(6)8(10)12-11-5/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=YQHJFAIHEUEONM-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(NN=C2I)=CC(Br)=C1

Synonyms:

• 1H-Indazole, 6-bromo-3-iodo-4-methoxy-
• 6-Bromo-3-iodo-4-methoxy-1H-indazole