CymitQuimica logo

CAS 887571-42-8

:

5-Chloro-3-thiophenesulfonamide

Description:
5-Chloro-3-thiophenesulfonamide is a chemical compound characterized by its unique structure, which includes a thiophene ring and a sulfonamide functional group. The presence of the chlorine atom at the 5-position of the thiophene ring contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the sulfonamide group, which can engage in hydrogen bonding. Its sulfonamide moiety is known for its applications in medicinal chemistry, particularly in the development of antimicrobial agents. The compound may also display interesting electronic properties due to the conjugated system formed by the thiophene ring. Additionally, 5-Chloro-3-thiophenesulfonamide can be synthesized through various chemical reactions, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound holds significance in both research and pharmaceutical applications.
Formula:C4H4ClNO2S2
InChI:InChI=1S/C4H4ClNO2S2/c5-4-1-3(2-9-4)10(6,7)8/h1-2H,(H2,6,7,8)
InChI key:InChIKey=PBJIEHRNSCJSPN-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1C=C(Cl)SC1
Synonyms:
  • 5-Chloro-3-thiophenesulfonamide
  • 3-Thiophenesulfonamide, 5-chloro-
  • 5-Chlorothiophene-3-sulfonamide
Found 0 products.