CAS 887572-34-1

6-chloro-4-ethoxypyridine-3-carboxylic acid

Description:

6-Chloro-4-ethoxypyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which contains a chlorine substituent at the 6-position and an ethoxy group at the 4-position, along with a carboxylic acid functional group at the 3-position. This compound typically exhibits properties associated with pyridine derivatives, such as moderate polarity and the ability to participate in hydrogen bonding due to the carboxylic acid group. The presence of the chlorine atom can influence its reactivity and solubility, while the ethoxy group may enhance lipophilicity. It is often utilized in pharmaceutical and agrochemical research due to its potential biological activity. The compound's structure allows for various synthetic modifications, making it a valuable intermediate in organic synthesis. Additionally, its unique combination of functional groups may contribute to specific interactions in biological systems, warranting further investigation into its pharmacological properties.

Formula: C₈H₈ClNO₃

InChI: InChI=1/C8H8ClNO3/c1-2-13-6-3-7(9)10-4-5(6)8(11)12/h3-4H,2H2,1H3,(H,11,12)

SMILES: CCOc1cc(Cl)ncc1C(=O)O

Synonyms:

• 3-Pyridinecarboxylic Acid, 6-Chloro-4-Ethoxy-
• 6-Chloro-4-ethoxynicotinic acid

6-Chloro-4-ethoxynicotinic acid

CAS: 887572-34-1

Formula: C₈H₈ClNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.6070

Ref: IN-DA00GSYA

6-Chloro-4-ethoxynicotinic acid

CAS: 887572-34-1

6-Chloro-4-ethoxynicotinic acid

Purity: 95%

Molecular weight: 201.61g/mol

Ref: 54-OR1004738

6-Chloro-4-ethoxynicotinic acid

CAS: 887572-34-1

Formula: C₈H₈ClNO₃

Purity: 98%

Molecular weight: 201.61

Ref: 10-F224270