CAS 887576-04-7
:1-Propanone, 1-(2,4-dichloro-5-fluorophenyl)-
Description:
1-Propanone, 1-(2,4-dichloro-5-fluorophenyl)-, also known by its CAS number 887576-04-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with a phenyl group that is substituted with two chlorine atoms and one fluorine atom, contributing to its unique chemical properties. The presence of these halogen substituents can significantly influence the compound's reactivity, polarity, and overall stability. Typically, such halogenated compounds exhibit increased lipophilicity, which can affect their biological activity and environmental behavior. The compound may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Additionally, its synthesis and handling require careful consideration of safety protocols due to the presence of halogens, which can pose toxicity risks. Overall, 1-Propanone, 1-(2,4-dichloro-5-fluorophenyl)- is a notable compound in organic chemistry with specific characteristics that make it of interest in various scientific fields.
Formula:C9H7Cl2FO
InChI:InChI=1S/C9H7Cl2FO/c1-2-9(13)5-3-8(12)7(11)4-6(5)10/h3-4H,2H2,1H3
InChI key:InChIKey=SGCJSUDCHRZMIG-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=C(Cl)C=C(Cl)C(F)=C1
Synonyms:- 1-Propanone, 1-(2,4-dichloro-5-fluorophenyl)-
- 1-(2,4-Dichloro-5-fluorophenyl)propan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
