CymitQuimica logo

CAS 887576-33-2

:

N-methoxy-N-methyl-4-morpholino-benzamide

Description:
N-methoxy-N-methyl-4-morpholino-benzamide, identified by its CAS number 887576-33-2, is a chemical compound characterized by its specific functional groups and structural features. It contains a benzamide core, which is a derivative of benzoic acid where the carboxylic acid group is replaced by an amide group. The presence of a morpholino group, a six-membered ring containing both nitrogen and oxygen, contributes to its potential biological activity and solubility properties. The methoxy and methyl substituents enhance its lipophilicity, which may influence its pharmacokinetic properties. This compound may exhibit various interactions due to its polar and non-polar regions, making it of interest in medicinal chemistry and drug design. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular environment and conditions under which it is studied. As with many organic compounds, safety data and handling precautions are essential for laboratory work involving this substance.
Formula:C13H18N2O3
InChI:InChI=1/C13H18N2O3/c1-14(17-2)13(16)11-3-5-12(6-4-11)15-7-9-18-10-8-15/h3-6H,7-10H2,1-2H3
SMILES:CN(C(=O)c1ccc(cc1)N1CCOCC1)OC
Synonyms:
  • 4-(N-Morephorinyl)-N,N-methoxy-methylbezamide
  • benzamide, N-methoxy-N-methyl-4-(4-morpholinyl)-
  • N-Methoxy-N-methyl-4-(morpholin-4-yl)benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.