CymitQuimica logo

CAS 887576-99-0

:

1-[4-[(5,6,7,8-Tetrahydro-2-naphthalenyl)oxy]phenyl]ethanone

Description:
1-[4-[(5,6,7,8-Tetrahydro-2-naphthalenyl)oxy]phenyl]ethanone, with the CAS number 887576-99-0, is an organic compound characterized by its complex structure, which includes a phenyl group, an ether linkage, and a ketone functional group. This compound features a tetrahydronaphthalene moiety, contributing to its hydrophobic characteristics and potential biological activity. The presence of the ketone functional group suggests that it may participate in various chemical reactions, such as nucleophilic additions or reductions. Additionally, the ether linkage enhances its solubility in organic solvents while potentially influencing its reactivity and stability. The compound's structural features may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its unique arrangement of functional groups could lead to interesting interactions with biological targets, making it a subject of interest for further research in drug discovery and development. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C18H18O2
InChI:InChI=1S/C18H18O2/c1-13(19)14-6-9-17(10-7-14)20-18-11-8-15-4-2-3-5-16(15)12-18/h6-12H,2-5H2,1H3
InChI key:InChIKey=BKGSUNWBSCJTGF-UHFFFAOYSA-N
SMILES:O(C=1C=C2C(=CC1)CCCC2)C3=CC=C(C(C)=O)C=C3
Synonyms:
  • 1-[4-[(5,6,7,8-Tetrahydro-2-naphthalenyl)oxy]phenyl]ethanone
  • Ethanone, 1-[4-[(5,6,7,8-tetrahydro-2-naphthalenyl)oxy]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.