
CAS 887577-56-2
:2-[(4-Hydroxy-1-piperidinyl)methyl]benzenecarboximidamide
Description:
2-[(4-Hydroxy-1-piperidinyl)methyl]benzenecarboximidamide, identified by its CAS number 887577-56-2, is a chemical compound characterized by its unique structural features. It contains a benzenecarboximidamide moiety, which is linked to a piperidine ring that has a hydroxyl group at the 4-position. This structure contributes to its potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit properties relevant to pharmacology. The presence of the hydroxyl group can enhance solubility and influence interactions with biological targets. Additionally, the carboximidamide functional group may play a role in hydrogen bonding and reactivity, making it a candidate for various applications, including as a pharmaceutical agent. The compound's molecular weight, solubility, and stability would depend on its specific chemical environment and conditions. Overall, 2-[(4-Hydroxy-1-piperidinyl)methyl]benzenecarboximidamide represents a class of compounds that may be of interest in drug development and research.
Formula:C13H19N3O
InChI:InChI=1S/C13H19N3O/c14-13(15)12-4-2-1-3-10(12)9-16-7-5-11(17)6-8-16/h1-4,11,17H,5-9H2,(H3,14,15)
InChI key:InChIKey=QYMVDSWWPDYIJO-UHFFFAOYSA-N
SMILES:C(C1=C(C(=N)N)C=CC=C1)N2CCC(O)CC2
Synonyms:- Benzenecarboximidamide, 2-[(4-hydroxy-1-piperidinyl)methyl]-
- 2-[(4-Hydroxy-1-piperidinyl)methyl]benzenecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenecarboximidamide,2-[(4-hydroxy-1-piperidinyl)methyl]-
CAS:Formula:C13H19N3OMolecular weight:233.3095
