
CAS 887578-17-8
:Ethyl 3-[(4-hydroxy-1-piperidinyl)methyl]benzenecarboximidate
Description:
Ethyl 3-[(4-hydroxy-1-piperidinyl)methyl]benzenecarboximidate, with the CAS number 887578-17-8, is a chemical compound characterized by its unique structure, which includes an ethyl ester group, a benzenecarboximidate moiety, and a piperidine ring substituted with a hydroxyl group. This compound typically exhibits properties associated with both amines and carboxylic acids due to the presence of the piperidine and carboximidate functional groups. It may display moderate solubility in polar solvents, reflecting the influence of the hydroxyl group and the ethyl ester. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, due to the reactivity of the carboximidate functional group. Overall, this compound's structural features suggest it could be of interest in both synthetic organic chemistry and pharmaceutical research.
Formula:C15H22N2O2
InChI:InChI=1S/C15H22N2O2/c1-2-19-15(16)13-5-3-4-12(10-13)11-17-8-6-14(18)7-9-17/h3-5,10,14,16,18H,2,6-9,11H2,1H3
InChI key:InChIKey=REFXBOONCBPFFH-UHFFFAOYSA-N
SMILES:C(C1=CC(C(OCC)=N)=CC=C1)N2CCC(O)CC2
Synonyms:- Benzenecarboximidic acid, 3-[(4-hydroxy-1-piperidinyl)methyl]-, ethyl ester
- Ethyl 3-[(4-hydroxy-1-piperidinyl)methyl]benzenecarboximidate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenecarboximidicacid, 3-[(4-hydroxy-1-piperidinyl)methyl]-, ethyl ester
CAS:Formula:C15H22N2O2Molecular weight:262.3474
