CAS 887578-22-5

6-(Ethylthio)-3-pyridinecarboxylic acid

Description:

6-(Ethylthio)-3-pyridinecarboxylic acid, identified by its CAS number 887578-22-5, is an organic compound characterized by the presence of a pyridine ring substituted with both an ethylthio group and a carboxylic acid functional group. The ethylthio group contributes to its unique chemical properties, potentially influencing its reactivity and solubility. This compound typically exhibits moderate polarity due to the presence of the carboxylic acid, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The pyridine ring provides basicity and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₈H₉NO₂S

InChI: InChI=1S/C8H9NO2S/c1-2-12-7-4-3-6(5-9-7)8(10)11/h3-5H,2H2,1H3,(H,10,11)

InChI key: InChIKey=PZQGEXFLCREFKL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=CC(SCC)=NC1

Synonyms:

• 3-Pyridinecarboxylic acid, 6-(ethylthio)-
• 6-(Ethylthio)-3-pyridinecarboxylic acid
• 2-(Ethylsulfanyl)pyridine-5-carboxylic acid

6-(Ethylsulfanyl)pyridine-3-carboxylic acid

CAS: 887578-22-5

6-(Ethylsulfanyl)pyridine-3-carboxylic acid (ESPCA) is a peptide that belongs to the class of activators. It has been shown to act as an inhibitor of ion channels, such as those found in the heart and brain. ESPCA also acts as an inhibitor of receptor interactions and ligand binding. The molecule has been shown to bind to proteins, including antibodies, which may be due to its structural similarity to L-leucine.

Formula: C₈H₉NO₂S

Purity: Min. 95%

Molecular weight: 183.23 g/mol

Ref: 3D-MKB57822