CymitQuimica logo

CAS 887578-24-7

:

Ethyl 4-[(4-hydroxy-1-piperidinyl)methyl]benzenecarboximidate

Description:
Ethyl 4-[(4-hydroxy-1-piperidinyl)methyl]benzenecarboximidate is a chemical compound characterized by its unique structure, which includes an ethyl ester group, a benzenecarboximidate moiety, and a piperidine ring with a hydroxyl substituent. This compound typically exhibits properties associated with both amines and carboxylic acid derivatives, such as potential solubility in polar solvents due to the presence of the hydroxyl group. The piperidine ring contributes to its basicity and may influence its reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the carboximidate functional group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets. The compound's molecular structure allows for various functional modifications, which can be explored for enhancing its biological activity or optimizing its physicochemical properties. Overall, Ethyl 4-[(4-hydroxy-1-piperidinyl)methyl]benzenecarboximidate represents a versatile scaffold in organic synthesis and drug development.
Formula:C15H22N2O2
InChI:InChI=1S/C15H22N2O2/c1-2-19-15(16)13-5-3-12(4-6-13)11-17-9-7-14(18)8-10-17/h3-6,14,16,18H,2,7-11H2,1H3
InChI key:InChIKey=QTRYTQBOQQEMAJ-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C(OCC)=N)C=C1)N2CCC(O)CC2
Synonyms:
  • Benzenecarboximidic acid, 4-[(4-hydroxy-1-piperidinyl)methyl]-, ethyl ester
  • Ethyl 4-[(4-hydroxy-1-piperidinyl)methyl]benzenecarboximidate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.