CAS 887578-66-7
:3-pyridin-2-ylpropanimidamide
Description:
3-Pyridin-2-ylpropanimidamide is an organic compound characterized by its unique structure, which includes a pyridine ring and an amidine functional group. The presence of the pyridine moiety contributes to its aromatic properties and potential for hydrogen bonding, while the propanimidamide portion introduces basicity and reactivity typical of amidines. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility characteristics can vary depending on the solvent, and it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound's molecular interactions can be influenced by the presence of functional groups, which may affect its stability and reactivity. Additionally, 3-pyridin-2-ylpropanimidamide may serve as a building block for synthesizing more complex molecules in organic synthesis. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C8H11N3
InChI:InChI=1/C8H11N3/c9-8(10)5-4-7-3-1-2-6-11-7/h1-3,6H,4-5H2,(H3,9,10)
SMILES:c1ccnc(c1)CCC(=N)N
Synonyms:- 2-Pyridinepropanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
