CAS 887578-93-0
:4-(3-pyridyl)butanamidine
Description:
4-(3-Pyridyl)butanamidine is an organic compound characterized by its amine functional group and a pyridine ring. It features a butanamidine backbone, which consists of a four-carbon chain terminating in an amidine group (–C(=NH)–NH2). The presence of the pyridine ring, a six-membered aromatic heterocycle containing one nitrogen atom, contributes to the compound's unique chemical properties, including its potential for hydrogen bonding and its role as a weak base. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the pyridine ring and the amidine group. Overall, 4-(3-pyridyl)butanamidine is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.
Formula:C9H13N3
InChI:InChI=1/C9H13N3/c10-9(11)5-1-3-8-4-2-6-12-7-8/h2,4,6-7H,1,3,5H2,(H3,10,11)
SMILES:C(Cc1cccnc1)CC(=N)N
Synonyms:- 3-Pyridinebutanimidamide
- 4-(Pyridin-3-yl)butanimidamide
- 4-pyridin-3-ylbutanimidamide
- 4-PYRIDIN-3-YL-BUTYRAMIDINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
