CAS 887579-82-0
:5-(Aminomethyl)-3-pyridinecarboxaldehyde
Description:
5-(Aminomethyl)-3-pyridinecarboxaldehyde, with the CAS number 887579-82-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an aldehyde functional group (-CHO) and an aminomethyl group (-CH2NH2) attached to the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino and aldehyde groups. The compound can participate in various chemical reactions, including nucleophilic additions and condensation reactions, making it useful in the synthesis of more complex molecules. Its unique structure allows it to serve as a building block in medicinal chemistry and the development of pharmaceuticals. Additionally, the presence of both amino and aldehyde functionalities may impart biological activity, warranting further investigation into its potential applications in drug discovery and development.
Formula:C7H8N2O
InChI:InChI=1/C7H8N2O/c8-2-6-1-7(5-10)4-9-3-6/h1,3-5H,2,8H2
SMILES:c1c(CN)cncc1C=O
Synonyms:- 3-Pyridinecarboxaldehyde, 5-(Aminomethyl)-
- 5-(Aminomethyl)nicotinaldehyde
- 5-Formyl-3-pyridinemethanamine
- 5-(Aminomethyl)Pyridine-3-Carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
