CAS 887580-27-0

1-[2-(aminomethyl)benzyl]piperidin-4-ol

Description:

1-[2-(Aminomethyl)benzyl]piperidin-4-ol, identified by its CAS number 887580-27-0, is a chemical compound that features a piperidine ring substituted with a benzyl group and an aminomethyl group. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the hydroxyl group at the 4-position of the piperidine ring suggests that it may exhibit properties such as hydrogen bonding, which can influence its solubility and reactivity. The aminomethyl substituent can enhance its interaction with biological targets, potentially affecting its pharmacological profile. This compound may be studied for its role in various therapeutic applications, particularly in the development of drugs targeting neurological or psychiatric disorders. Its characteristics, including molecular weight, solubility, and stability, would be essential for understanding its behavior in biological systems and its suitability for further research or application in drug development.

Formula: C₁₃H₂₀N₂O

InChI: InChI=1/C13H20N2O/c14-9-11-3-1-2-4-12(11)10-15-7-5-13(16)6-8-15/h1-4,13,16H,5-10,14H2

SMILES: c1ccc(CN2CCC(CC2)O)c(c1)CN

1-([2-(Aminomethyl)phenyl]methyl)piperidin-4-ol

CAS: 887580-27-0

Formula: C₁₃H₂₀N₂O

Molecular weight: 220.3107

Ref: IN-DA008BM5

1-{[2-(Aminomethyl)phenyl]methyl}piperidin-4-ol

CAS: 887580-27-0

Versatile small molecule scaffold

Formula: C₁₃H₂₀N₂O

Purity: Min. 95%

Molecular weight: 220.31 g/mol

Ref: 3D-MKB58027