CymitQuimica logo

CAS 887580-43-0

:

3-([1,1′-Biphenyl]-4-yloxy)benzenamine

Description:
3-([1,1′-Biphenyl]-4-yloxy)benzenamine, with the CAS number 887580-43-0, is an organic compound characterized by its biphenyl and aniline functional groups. This compound features a biphenyl moiety linked to a phenolic ether, which is further connected to an amine group. The presence of the biphenyl structure contributes to its potential applications in organic electronics and materials science due to its planar structure and ability to facilitate π-π stacking interactions. The amine group can participate in hydrogen bonding, influencing the compound's solubility and reactivity. Additionally, the ether linkage may enhance the compound's stability and modify its electronic properties. Overall, this compound's unique structural features suggest potential utility in various chemical applications, including as a building block in the synthesis of more complex organic molecules or as a functional material in advanced technologies. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be determined through experimental methods or detailed literature review.
Formula:C18H15NO
InChI:InChI=1S/C18H15NO/c19-16-7-4-8-18(13-16)20-17-11-9-15(10-12-17)14-5-2-1-3-6-14/h1-13H,19H2
InChI key:InChIKey=YJQRLTCXYNGNSE-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C=C1)C2=CC=CC=C2)C3=CC(N)=CC=C3
Synonyms:
  • 3-(BIPHENYL-4-YLOXY)-PHENYLAMINE
  • Benzenamine, 3-([1,1′-biphenyl]-4-yloxy)-
  • 3-([1,1′-Biphenyl]-4-yloxy)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.