CAS 887580-47-4

2-Amino-4-pyridineacetic acid

Description:

2-Amino-4-pyridineacetic acid, with the CAS number 887580-47-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the pyridine ring, contributing to its properties as an amino acid derivative. It is typically a white to off-white solid and is soluble in water due to the presence of the polar carboxylic acid and amino groups. The compound exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, including those typical of amino acids. Its biological significance may include roles in biochemical pathways or as a potential building block for pharmaceuticals. Additionally, its structural features may influence its reactivity and interactions with other molecules, making it of interest in medicinal chemistry and materials science. Overall, 2-Amino-4-pyridineacetic acid is a versatile compound with potential applications in various fields.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c8-6-3-5(1-2-9-6)4-7(10)11/h1-3H,4H2,(H2,8,9)(H,10,11)

SMILES: c1c[nH]c(=N)cc1CC(=O)O

Synonyms:

• (2-Aminopyridin-4-yl)acetic acid
• 2-Amino-4-pyridine acetic acid
• 4-Pyridineacetic Acid, 2-Amino-
• 2-(2-Amino-4-Pyridyl)Acetic Acid

2-Amino-4-pyridineacetic acid

CAS: 887580-47-4

Formula: C₇H₈N₂O₂

Molecular weight: 152.1506

Ref: IN-DA008BM3