CAS 887580-75-8

1,1-Dimethylethyl 3-[(4-pyridinylmethyl)amino]-1-azetidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(4-pyridinylmethyl)amino]-1-azetidinecarboxylate, identified by its CAS number 887580-75-8, is a chemical compound that features a unique structure combining an azetidine ring with a carboxylate functional group and a pyridine moiety. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its role as a pharmacophore. The presence of the dimethyl group contributes to steric hindrance, which can influence the compound's reactivity and interaction with biological targets. The pyridine ring is known for its ability to participate in hydrogen bonding and coordination with metal ions, enhancing the compound's potential as a ligand in various chemical reactions. Additionally, the azetidine ring structure may impart specific conformational properties that affect the compound's overall stability and solubility. Overall, this compound's unique combination of functional groups makes it a subject of interest in drug discovery and development, particularly in the search for new therapeutic agents.

Formula: C₁₄H₂₁N₃O₂

InChI: InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)17-9-12(10-17)16-8-11-4-6-15-7-5-11/h4-7,12,16H,8-10H2,1-3H3

InChI key: InChIKey=WVYKGUIVJGCIIP-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(NCC=2C=CN=CC2)C1

Synonyms:

• 1,1-Dimethylethyl 3-[(4-pyridinylmethyl)amino]-1-azetidinecarboxylate
• 1-Azetidinecarboxylic acid, 3-[(4-pyridinylmethyl)amino]-, 1,1-dimethylethyl ester