
CAS 887581-10-4
:3-(Aminomethyl)-1H-indole-5-carbonitrile
Description:
3-(Aminomethyl)-1H-indole-5-carbonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features an aminomethyl group and a cyano group at specific positions on the indole ring, contributing to its unique reactivity and potential biological activity. The presence of the amino group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. The cyano group can also enhance the compound's polarity and solubility in polar solvents. Additionally, compounds with indole structures are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular weight, solubility, and specific reactivity of 3-(Aminomethyl)-1H-indole-5-carbonitrile would depend on its structural features and the functional groups present, which can influence its interactions in biological systems and its utility in various chemical applications.
Formula:C10H9N3
InChI:InChI=1S/C10H9N3/c11-4-7-1-2-10-9(3-7)8(5-12)6-13-10/h1-3,6,13H,5,12H2
InChI key:InChIKey=UPZDYTARJKBWAT-UHFFFAOYSA-N
SMILES:C(N)C=1C=2C(NC1)=CC=C(C#N)C2
Synonyms:- 1H-Indole-5-carbonitrile, 3-(aminomethyl)-
- 3-(Aminomethyl)-1H-indole-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.