CAS 887581-15-9
:2-chloro-3-(2-chloroethyl)-6-methoxyquinoline
Description:
2-Chloro-3-(2-chloroethyl)-6-methoxyquinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features two chlorine substituents and a methoxy group, which influence its chemical reactivity and physical properties. The presence of the chloroethyl group suggests potential for nucleophilic substitution reactions, while the methoxy group can affect the compound's solubility and polarity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure contributes to its potential interactions with biological targets, and its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment. Safety data and handling precautions are essential due to the presence of chlorine atoms, which can pose health risks. Overall, 2-chloro-3-(2-chloroethyl)-6-methoxyquinoline is a compound of interest for further research in various chemical and pharmaceutical applications.
Formula:C12H11Cl2NO
InChI:InChI=1/C12H11Cl2NO/c1-16-10-2-3-11-9(7-10)6-8(4-5-13)12(14)15-11/h2-3,6-7H,4-5H2,1H3
SMILES:COc1ccc2c(cc(CCCl)c(Cl)n2)c1
Synonyms:- Quinoline, 2-Chloro-3-(2-Chloroethyl)-6-Methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.