
CAS 887581-42-2
:7-Bromo-1H-indole-3-methanamine
Description:
7-Bromo-1H-indole-3-methanamine is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 7-position of the indole ring contributes to its reactivity and potential applications in medicinal chemistry. The methanamine group at the 3-position introduces an amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular properties, such as solubility, stability, and reactivity, can be influenced by the bromine substituent and the amine group. Additionally, the compound's CAS number, 887581-42-2, serves as a unique identifier for regulatory and safety information. Overall, 7-Bromo-1H-indole-3-methanamine is a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C9H9BrN2
InChI:InChI=1S/C9H9BrN2/c10-8-3-1-2-7-6(4-11)5-12-9(7)8/h1-3,5,12H,4,11H2
InChI key:InChIKey=WYBJUXJPUNFHQA-UHFFFAOYSA-N
SMILES:C(N)C=1C=2C(=C(Br)C=CC2)NC1
Synonyms:- 1H-Indole-3-methanamine, 7-bromo-
- 7-Bromo-1H-indole-3-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
