CAS 887582-81-2
:Methyl 3-(aminomethyl)-1H-indole-6-carboxylate
Description:
Methyl 3-(aminomethyl)-1H-indole-6-carboxylate, identified by its CAS number 887582-81-2, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of an aminomethyl group and a carboxylate ester functional group, which contribute to its reactivity and potential biological activity. The methyl ester group enhances its solubility in organic solvents, making it useful in various synthetic applications. The indole moiety is known for its occurrence in many natural products and pharmaceuticals, often exhibiting significant biological properties, including antimicrobial and anticancer activities. The presence of the amino group may also facilitate interactions with biological targets, potentially influencing its pharmacological profile. Overall, Methyl 3-(aminomethyl)-1H-indole-6-carboxylate is of interest in medicinal chemistry and drug development due to its structural features and potential therapeutic applications.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-15-11(14)7-2-3-9-8(5-12)6-13-10(9)4-7/h2-4,6,13H,5,12H2,1H3
InChI key:InChIKey=AWFGKILIWDEBOJ-UHFFFAOYSA-N
SMILES:C(N)C=1C=2C(=CC(C(OC)=O)=CC2)NC1
Synonyms:- Methyl 3-(aminomethyl)-1H-indole-6-carboxylate
- 1H-Indole-6-carboxylic acid, 3-(aminomethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
