CymitQuimica logo

CAS 887583-54-2

:

4-(Aminomethyl)-1-naphthalenol

Description:
4-(Aminomethyl)-1-naphthalenol, with the CAS number 887583-54-2, is an organic compound characterized by its naphthalene structure, which features an amino group and a hydroxyl group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The amino group contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The presence of both functional groups makes it a candidate for applications in pharmaceuticals, dyes, or as an intermediate in organic synthesis. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is handled. Safety data should be consulted to understand its toxicity and handling precautions, as compounds with amino and hydroxyl groups can exhibit biological activity and may require careful management in laboratory settings.
Formula:C11H11NO
InChI:InChI=1S/C11H11NO/c12-7-8-5-6-11(13)10-4-2-1-3-9(8)10/h1-6,13H,7,12H2
InChI key:InChIKey=NEXBEXIEUGVLCR-UHFFFAOYSA-N
SMILES:C(N)C=1C2=C(C(O)=CC1)C=CC=C2
Synonyms:
  • 1-Naphthalenol, 4-(aminomethyl)-
  • 4-(Aminomethyl)-1-naphthalenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.