CAS 887583-71-3
:1-[2-[(tert-Butyldiphenylsilyl)oxy]ethyl]piperazine
Description:
1-[2-[(tert-Butyldiphenylsilyl)oxy]ethyl]piperazine, with the CAS number 887583-71-3, is an organic compound characterized by its unique structural features. It contains a piperazine ring, which is a six-membered cyclic amine, providing it with potential biological activity. The presence of a tert-butyldiphenylsilyl group enhances its stability and lipophilicity, making it suitable for various applications in medicinal chemistry and material science. The ether functionality, indicated by the silyl ether moiety, contributes to its solubility properties and reactivity. This compound may exhibit interesting pharmacological properties due to the piperazine core, which is often found in numerous pharmaceutical agents. Additionally, the bulky silyl group can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets. Overall, this compound represents a versatile scaffold for further chemical modifications and investigations in drug development and synthesis.
Formula:C22H32N2OSi
InChI:InChI=1S/C22H32N2OSi/c1-22(2,3)26(20-10-6-4-7-11-20,21-12-8-5-9-13-21)25-19-18-24-16-14-23-15-17-24/h4-13,23H,14-19H2,1-3H3
InChI key:InChIKey=VHTGWHWKPHHGHK-UHFFFAOYSA-N
SMILES:[Si](OCCN1CCNCC1)(C(C)(C)C)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 1-[2-[(tert-Butyldiphenylsilyl)oxy]ethyl]piperazine
- 1-[2-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]ethyl]piperazine
- Piperazine, 1-[2-[[(1,1-dimethylethyl)diphenylsilyl]oxy]ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
