CAS 887583-90-6
:4-bromo-2-(trifluoromethyl)pyridine
Description:
4-Bromo-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a bromine atom at the 4-position and a trifluoromethyl group at the 2-position. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dichloromethane and acetone, but has limited solubility in water due to its nonpolar trifluoromethyl group. The presence of the bromine and trifluoromethyl groups contributes to its unique electronic properties, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group enhances lipophilicity and metabolic stability, which can influence the biological activity of derivatives. The compound's reactivity can be attributed to the electrophilic nature of the bromine atom, allowing for further functionalization. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 4-bromo-2-(trifluoromethyl)pyridine is a significant compound in synthetic organic chemistry with diverse applications.
Formula:C6H3BrF3N
InChI:InChI=1/C6H3BrF3N/c7-4-1-2-11-5(3-4)6(8,9)10/h1-3H
SMILES:c1cnc(cc1Br)C(F)(F)F
Synonyms:- 4-Bromo-2-trifluoromethylpyridine
- Pyridine, 4-Bromo-2-(Trifluoromethyl)-
- 2-(Trifluoromethyl)-4-bromopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-BROMO-2-TRIFLUOROMETHYLPYRIDINE
CAS:Formula:C6H3BrF3NPurity:96%Color and Shape:LiquidMolecular weight:225.9939Ref: IN-DA004BYG
1g25.00€5g50.00€10g71.00€1kgTo inquire25g111.00€50g211.00€5kgTo inquire100g282.00€250g587.00€4-Bromo-2-(trifluoromethyl)pyridine
CAS:4-Bromo-2-(trifluoromethyl)pyridineFormula:C6H3BrF3NPurity:98%Color and Shape: colourless liquidMolecular weight:225.99g/mol4-Bromo-2-(trifluoromethyl)pyridine
CAS:Formula:C6H3BrF3NPurity:96%Color and Shape:ClearMolecular weight:225.9964-Bromo-2-(trifluoromethyl)pyridine
CAS:Controlled Product<p>Applications 4-Bromo-2-(trifluoromethyl)pyridine is used in the synthesis of a potent and selective Class IIa histone deacetylase inhibitors as a potential therapy for Huntington’s disease.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Burli, R.W., et al.: J. Med. Chem., 56, 9934 (2013)<br></p>Formula:C6H3BrF3NColor and Shape:NeatMolecular weight:225.99




