CAS 887584-15-8

1,1-Dimethylethyl 3-[(3-bromophenyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(3-bromophenyl)amino]-1-piperidinecarboxylate, identified by its CAS number 887584-15-8, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and a bromophenyl moiety, indicating the presence of a bromine atom attached to a phenyl ring. The piperidinecarboxylate structure suggests that it has potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or active ingredient. The presence of the amino group linked to the aromatic ring may contribute to its biological activity, influencing interactions with various biological targets. Additionally, the bromine substituent can enhance lipophilicity and affect the compound's pharmacokinetic properties. Overall, this compound's unique structural features may provide insights into its reactivity, stability, and potential therapeutic applications. However, specific properties such as solubility, melting point, and biological activity would require further empirical investigation.

Formula: C₁₆H₂₃BrN₂O₂

InChI: InChI=1S/C16H23BrN2O2/c1-16(2,3)21-15(20)19-9-5-8-14(11-19)18-13-7-4-6-12(17)10-13/h4,6-7,10,14,18H,5,8-9,11H2,1-3H3

InChI key: InChIKey=SVYRSMAAZQQJIN-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(NC2=CC(Br)=CC=C2)CCC1

Synonyms:

• 1,1-Dimethylethyl 3-[(3-bromophenyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[(3-bromophenyl)amino]-, 1,1-dimethylethyl ester

1-Piperidinecarboxylicacid, 3-[(3-bromophenyl)amino]-, 1,1-dimethylethyl ester

CAS: 887584-15-8

Formula: C₁₆H₂₃BrN₂O₂

Molecular weight: 355.27

Ref: IN-DA004DV3