CymitQuimica logo

CAS 887584-15-8

:

1,1-Dimethylethyl 3-[(3-bromophenyl)amino]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 3-[(3-bromophenyl)amino]-1-piperidinecarboxylate, identified by its CAS number 887584-15-8, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and a bromophenyl moiety, indicating the presence of a bromine atom attached to a phenyl ring. The piperidinecarboxylate structure suggests that it has potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or active ingredient. The presence of the amino group linked to the aromatic ring may contribute to its biological activity, influencing interactions with various biological targets. Additionally, the bromine substituent can enhance lipophilicity and affect the compound's pharmacokinetic properties. Overall, this compound's unique structural features may provide insights into its reactivity, stability, and potential therapeutic applications. However, specific properties such as solubility, melting point, and biological activity would require further empirical investigation.
Formula:C16H23BrN2O2
InChI:InChI=1S/C16H23BrN2O2/c1-16(2,3)21-15(20)19-9-5-8-14(11-19)18-13-7-4-6-12(17)10-13/h4,6-7,10,14,18H,5,8-9,11H2,1-3H3
InChI key:InChIKey=SVYRSMAAZQQJIN-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(NC2=CC(Br)=CC=C2)CCC1
Synonyms:
  • 1,1-Dimethylethyl 3-[(3-bromophenyl)amino]-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 3-[(3-bromophenyl)amino]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.