CAS 887584-71-6
:6-Amino-2,3-dichlorobenzeneacetic acid
Description:
6-Amino-2,3-dichlorobenzeneacetic acid is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms and an amino group, along with an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amino and carboxylic acid groups. The dichlorobenzene substituents can influence its electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the amino group may participate in hydrogen bonding, affecting its physical properties and interactions with other molecules. This compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific uses would depend on its biological activity and stability. Safety data should be consulted to understand its handling and potential hazards, as the presence of chlorine atoms may impart toxicity or environmental concerns.
Formula:C8H7Cl2NO2
InChI:InChI=1S/C8H7Cl2NO2/c9-5-1-2-6(11)4(8(5)10)3-7(12)13/h1-2H,3,11H2,(H,12,13)
InChI key:InChIKey=WWDJCHBQVFGTME-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(Cl)C(Cl)=CC=C1N
Synonyms:- benzeneacetic acid, 6-amino-2,3-dichloro-
- 2,3-Dichloro-6-aminophenylacetic acid
- 6-Amino-2,3-dichlorobenzeneacetic acid
- (6-Amino-2,3-dichlorophenyl)acetic acid
- Benzeneacetic acid, 6-amino-2,3-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
