CAS 887584-98-7

3,4-difluoro-5-methoxy-benzoic acid

Description:

3,4-Difluoro-5-methoxy-benzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and a methoxy group attached to a benzoic acid framework. The fluorine substituents are located at the 3 and 4 positions of the benzene ring, while the methoxy group is positioned at the 5 position. This compound exhibits both acidic and polar characteristics due to the carboxylic acid functional group, which can donate protons in solution. The presence of fluorine atoms enhances its electronegativity, potentially influencing its reactivity and solubility in various solvents. The methoxy group contributes to the compound's overall hydrophobic character while also providing potential sites for hydrogen bonding. 3,4-Difluoro-5-methoxy-benzoic acid may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals or agrochemicals, owing to its unique structural features. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases.

Formula: C₈H₆F₂O₃

InChI: InChI=1/C8H6F2O3/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3H,1H3,(H,11,12)

SMILES: COc1cc(cc(c1F)F)C(=O)O

Synonyms:

• 3,4-Difluoro-5-methoxybenzoic acid
• 4,5-Difluoro-3-methoxybenzoic acid
• Benzoic Acid, 3,4-Difluoro-5-Methoxy-

3,4-Difluoro-5-methoxybenzoic acid

CAS: 887584-98-7

Formula: C₈H₆F₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.1282

Ref: IN-DA004C2J

3,4-Difluoro-5-methoxybenzoic acid

CAS: 887584-98-7

3,4-Difluoro-5-methoxybenzoic acid

Purity: 98%

Molecular weight: 188.13g/mol

Ref: 54-PC103652

3,4-Difluoro-5-methoxybenzoic acid

CAS: 887584-98-7

Formula: C₈H₆F₂O₃

Purity: 98%

Molecular weight: 188.13

Ref: 10-F339772

3,4-Difluoro-5-methoxybenzoic acid

CAS: 887584-98-7

3,4-Difluoro-5-methoxybenzoic acid is a reactive compound that is produced as a Grignard reagent. It reacts with other organic compounds to form new compounds. 3,4-Difluoro-5-methoxybenzoic acid contains the methoxy group, which is found in many drugs. The methoxy group can be removed from 3,4-Difluoro-5-methoxybenzoic acid by reacting it with an alkali metal such as sodium hydroxide to produce 3,4-dihydroxybenzoic acid.

Formula: C₈H₆F₂O₃

Purity: Min. 95%

Molecular weight: 188.13 g/mol

Ref: 3D-MKB58498