CymitQuimica logo

CAS 887585-05-9

:

6-Amino-2,3-difluorobenzeneacetic acid

Description:
6-Amino-2,3-difluorobenzeneacetic acid is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two fluorine atoms and an amino group, as well as a carboxylic acid functional group. The presence of the amino group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The difluorobenzene moiety contributes to its unique electronic properties, potentially affecting its interaction with biological targets or other chemical species. This compound is likely to exhibit moderate polarity due to the combination of the hydrophilic carboxylic acid and the hydrophobic aromatic ring. Its fluorine substituents can enhance lipophilicity and may also impact its metabolic stability. 6-Amino-2,3-difluorobenzeneacetic acid may have applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. As with many fluorinated compounds, it is essential to consider its environmental impact and bioaccumulation potential during its use and disposal.
Formula:C8H7F2NO2
InChI:InChI=1S/C8H7F2NO2/c9-5-1-2-6(11)4(8(5)10)3-7(12)13/h1-2H,3,11H2,(H,12,13)
InChI key:InChIKey=NOFDHMCJUZZSIV-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(F)C(F)=CC=C1N
Synonyms:
  • Benzeneacetic acid, 6-amino-2,3-difluoro-
  • 6-Amino-2,3-difluorobenzeneacetic acid
Found 4 products.