CAS 887585-20-8
:5-(Bromomethyl)-1,2-difluoro-3-methoxybenzene
Description:
5-(Bromomethyl)-1,2-difluoro-3-methoxybenzene, identified by its CAS number 887585-20-8, is an organic compound characterized by the presence of a bromomethyl group, two fluorine atoms, and a methoxy group attached to a benzene ring. This compound features a substituted aromatic system, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The bromomethyl group can serve as a reactive site for further chemical transformations, while the difluoro and methoxy substituents can influence the compound's electronic properties and solubility. The presence of fluorine atoms typically enhances the compound's stability and lipophilicity, making it of interest in medicinal chemistry. Additionally, the methoxy group can participate in hydrogen bonding and may affect the compound's interaction with biological targets. Overall, this compound's unique structural features make it a valuable candidate for further research and development in synthetic organic chemistry.
Formula:C8H7BrF2O
InChI:InChI=1S/C8H7BrF2O/c1-12-7-3-5(4-9)2-6(10)8(7)11/h2-3H,4H2,1H3
InChI key:InChIKey=YBSQDVSUHYQQLV-UHFFFAOYSA-N
SMILES:O(C)C1=C(F)C(F)=CC(CBr)=C1
Synonyms:- 4-(Bromomethyl)-6-methoxy-1,2-difluorobenzene
- 5-(Bromomethyl)-1,2-difluoro-3-methoxybenzene
- 5-(Bromomethyl)-2,3-difluorophenyl methyl ether
- Benzene, 5-(Bromomethyl)-1,2-Difluoro-3-Methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
