CAS 887586-24-5
:2,3-Difluoro-6-iodobenzaldehyde
Description:
2,3-Difluoro-6-iodobenzaldehyde is an organic compound characterized by the presence of both fluorine and iodine substituents on a benzaldehyde framework. Specifically, it features two fluorine atoms located at the 2 and 3 positions of the benzene ring, and an iodine atom at the 6 position, along with an aldehyde functional group (-CHO) at the 1 position. This compound is typically a pale yellow to light brown solid, exhibiting a distinct aromatic odor. Its molecular structure contributes to its reactivity, particularly in electrophilic aromatic substitution reactions, and it may serve as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of halogens like fluorine and iodine can influence the compound's physical properties, such as solubility and boiling point, as well as its chemical behavior, including its potential for forming hydrogen bonds and participating in nucleophilic reactions. Additionally, 2,3-difluoro-6-iodobenzaldehyde may exhibit interesting electronic properties due to the electronegative nature of the halogens, which can affect its reactivity and interactions with other chemical species.
Formula:C7H3F2IO
InChI:InChI=1S/C7H3F2IO/c8-5-1-2-6(10)4(3-11)7(5)9/h1-3H
InChI key:InChIKey=VPURHZYVCAVPQJ-UHFFFAOYSA-N
SMILES:C(=O)C1=C(F)C(F)=CC=C1I
Synonyms:- 2,3-Difluoro-6-iodobenzaldehyde
- Benzaldehyde, 2,3-difluoro-6-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
