CymitQuimica logo

CAS 887586-55-2

:

β-Amino-5,6,7,8-tetrahydro-2-naphthalenepropanoic acid

Description:
β-Amino-5,6,7,8-tetrahydro-2-naphthalenepropanoic acid, with the CAS number 887586-55-2, is an organic compound characterized by its unique bicyclic structure, which includes a naphthalene moiety fused with a propanoic acid side chain. This compound features an amino group, contributing to its classification as an amino acid derivative. It is typically a white to off-white solid, soluble in polar solvents, and exhibits properties that may include moderate stability under standard conditions. The presence of the amino group allows for potential interactions in biological systems, making it of interest in medicinal chemistry and pharmacology. Its structural features may influence its reactivity, biological activity, and potential applications in drug development. As with many organic compounds, safety data should be consulted to understand its handling and toxicity. Overall, β-Amino-5,6,7,8-tetrahydro-2-naphthalenepropanoic acid represents a compound with intriguing chemical properties and potential utility in various scientific fields.
Formula:C13H17NO2
InChI:InChI=1S/C13H17NO2/c14-12(8-13(15)16)11-6-5-9-3-1-2-4-10(9)7-11/h5-7,12H,1-4,8,14H2,(H,15,16)
InChI key:InChIKey=GPQHIVDSBJLOKO-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(N)C=1C=C2C(=CC1)CCCC2
Synonyms:
  • 2-Naphthalenepropanoic acid, β-amino-5,6,7,8-tetrahydro-
  • β-Amino-5,6,7,8-tetrahydro-2-naphthalenepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.