CAS 887587-03-3
:(4-ethylbenzyl)hydrazine
Description:
(4-Ethylbenzyl)hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a 4-ethylbenzyl moiety. This compound features a hydrazine (-NH-NH2) group, which is known for its reactivity and ability to form various derivatives. The ethyl group at the para position of the benzyl ring contributes to its hydrophobic characteristics, potentially influencing its solubility in organic solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in the synthesis of more complex molecules, particularly in the fields of pharmaceuticals and agrochemicals. As with many hydrazine derivatives, safety precautions are necessary due to the potential for toxicity and reactivity. Proper handling and storage conditions are essential to mitigate risks associated with exposure. Overall, (4-ethylbenzyl)hydrazine represents a versatile building block in organic synthesis, with implications in various chemical research areas.
Formula:C9H14N2
InChI:InChI=1/C9H14N2/c1-2-8-3-5-9(6-4-8)7-11-10/h3-6,11H,2,7,10H2,1H3
SMILES:CCc1ccc(cc1)CNN
Synonyms:- 1-[(4-Ethylphenyl)Methyl]Hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
