CymitQuimica logo

CAS 887587-33-9

:

tert-butyl 3-(2-methoxyethylamino)pyrrolidine-1-carboxylate

Description:
Tert-butyl 3-(2-methoxyethylamino)pyrrolidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring, a tert-butyl group, and an amino substituent. This compound typically exhibits properties associated with both amines and carboxylates, such as potential basicity due to the amino group and the ability to form salts. The presence of the methoxyethyl group may enhance its solubility in organic solvents and influence its reactivity. Additionally, the tert-butyl group contributes to steric hindrance, which can affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may participate in hydrogen bonding, influencing its physical properties like boiling and melting points. Overall, tert-butyl 3-(2-methoxyethylamino)pyrrolidine-1-carboxylate is a versatile molecule with potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other therapeutic areas.
Formula:C12H24N2O3
InChI:InChI=1/C12H24N2O3/c1-12(2,3)17-11(15)14-7-5-10(9-14)13-6-8-16-4/h10,13H,5-9H2,1-4H3
SMILES:CC(C)(C)OC(=O)N1CCC(C1)NCCOC
Synonyms:
  • 1-Boc-3-(2-methoxyethylamino)pyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.