
CAS 887587-67-9
:1,1-Dimethylethyl 3-[(4-bromophenyl)sulfonyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 3-[(4-bromophenyl)sulfonyl]-1-pyrrolidinecarboxylate, with the CAS number 887587-67-9, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a carboxylate group and a sulfonyl moiety attached to a 4-bromophenyl group. The presence of the bulky tert-butyl group (1,1-dimethylethyl) enhances its steric properties, potentially influencing its reactivity and interactions in biological systems. This compound may exhibit specific pharmacological activities due to the presence of the sulfonyl and bromophenyl groups, which can affect its binding affinity to biological targets. Additionally, the overall lipophilicity and solubility of the compound can be influenced by its functional groups, making it relevant in medicinal chemistry and drug design. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied or utilized.
Formula:C15H20BrNO4S
InChI:InChI=1S/C15H20BrNO4S/c1-15(2,3)21-14(18)17-9-8-13(10-17)22(19,20)12-6-4-11(16)5-7-12/h4-7,13H,8-10H2,1-3H3
InChI key:InChIKey=IDEUDDPTYWBZEG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1CN(C(OC(C)(C)C)=O)CC1)C2=CC=C(Br)C=C2
Synonyms:- 1,1-Dimethylethyl 3-[(4-bromophenyl)sulfonyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 3-[(4-bromophenyl)sulfonyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Pyrrolidinecarboxylicacid, 3-[(4-bromophenyl)sulfonyl]-, 1,1-dimethylethyl ester
CAS:Formula:C15H20BrNO4SMolecular weight:390.2926
