
CAS 887588-63-8
:1-[[3-(Aminomethyl)phenyl]methyl]-4-piperidinol
Description:
1-[[3-(Aminomethyl)phenyl]methyl]-4-piperidinol, identified by its CAS number 887588-63-8, is a chemical compound characterized by its structural features that include a piperidine ring and an aminomethyl-substituted phenyl group. This compound typically exhibits properties associated with both amines and alcohols due to the presence of the amino and hydroxyl functional groups. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to its functional groups. The presence of the piperidine ring suggests that it may exhibit basic properties, while the hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific details regarding its toxicity, stability, and reactivity would require further investigation and analysis in a laboratory setting.
Formula:C13H20N2O
InChI:InChI=1S/C13H20N2O/c14-9-11-2-1-3-12(8-11)10-15-6-4-13(16)5-7-15/h1-3,8,13,16H,4-7,9-10,14H2
InChI key:InChIKey=FZBAJTZKEDTSPJ-UHFFFAOYSA-N
SMILES:C(C1=CC(CN)=CC=C1)N2CCC(O)CC2
Synonyms:- 1-[[3-(Aminomethyl)phenyl]methyl]-4-piperidinol
- 4-Piperidinol, 1-[[3-(aminomethyl)phenyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
