CAS 887588-67-2

1-[4-(aminomethyl)benzyl]piperidin-4-ol

Description:

1-[4-(Aminomethyl)benzyl]piperidin-4-ol, with the CAS number 887588-67-2, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a benzyl group substituted with an aminomethyl group at one position and a hydroxyl group at the piperidine's fourth position. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it a candidate for various applications in medicinal chemistry and drug development. The hydroxyl group contributes to its polarity, influencing solubility and interaction with biological systems. Additionally, the structural arrangement indicates that it may exhibit specific stereochemical properties, which can affect its biological activity. Overall, this compound's unique functional groups and structural features make it of interest in the synthesis of pharmaceuticals or as a research chemical in studies related to neurochemistry or other fields.

Formula: C₁₃H₂₀N₂O

InChI: InChI=1/C13H20N2O/c14-9-11-1-3-12(4-2-11)10-15-7-5-13(16)6-8-15/h1-4,13,16H,5-10,14H2

SMILES: c1cc(ccc1CN)CN1CCC(CC1)O

Synonyms:

• 1-(4-Aminomethyl-benzyl)-piperidin-4-ol

1-([4-(Aminomethyl)phenyl]methyl)piperidin-4-ol

CAS: 887588-67-2

Formula: C₁₃H₂₀N₂O

Molecular weight: 220.3107

Ref: IN-DA004DEX

1-{[4-(Aminomethyl)phenyl]methyl}piperidin-4-ol

CAS: 887588-67-2

Versatile small molecule scaffold

Formula: C₁₃H₂₀N₂O

Purity: Min. 95%

Molecular weight: 220.31 g/mol

Ref: 3D-MKB58867