
CAS 887589-52-8
:1,1-Cyclohexanediacetamide
Description:
1,1-Cyclohexanediacetamide, identified by its CAS number 887589-52-8, is an organic compound characterized by the presence of a cyclohexane ring with two acetamide functional groups attached to the same carbon atom. This unique structure imparts specific chemical properties, including potential solubility in polar solvents due to the amide groups, which can engage in hydrogen bonding. The compound may exhibit moderate stability under standard conditions, but its reactivity can be influenced by the presence of the acetamide groups, which can participate in various chemical reactions, such as nucleophilic substitutions or hydrolysis. Additionally, the cyclohexane ring contributes to the compound's overall hydrophobic character, affecting its interactions with other molecules. The compound's potential applications could span across fields such as pharmaceuticals, materials science, or organic synthesis, depending on its specific reactivity and properties. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with safety regulations.
Formula:C10H18N2O2
InChI:InChI=1S/C10H18N2O2/c11-8(13)6-10(7-9(12)14)4-2-1-3-5-10/h1-7H2,(H2,11,13)(H2,12,14)
InChI key:InChIKey=SXWAXFXBDRFFLU-UHFFFAOYSA-N
SMILES:C(C(N)=O)C1(CC(N)=O)CCCCC1
Synonyms:- 2-[1-(Carbamoylmethyl)cyclohexyl]acetamide
- 1,1-Cyclohexanediacetamide
- 2-[1-(2-amino-2-oxoethyl)cyclohexyl]acetamide
- 2,2'-(cyclohexane-1,1-diyl)diacetamide
- Gabapentin Impurity 30
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
