CAS 887590-22-9

1,1-Dimethylethyl 3-[(4-fluorophenyl)sulfonyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(4-fluorophenyl)sulfonyl]-1-piperidinecarboxylate, with the CAS number 887590-22-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a sulfonyl group, and a carboxylate moiety. This compound typically exhibits properties associated with both its piperidine and sulfonyl functionalities, such as potential solubility in polar solvents and the ability to participate in various chemical reactions, including nucleophilic substitutions. The presence of the fluorophenyl group may enhance its lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the dimethyl group contributes to steric hindrance, which can affect the compound's reactivity and interaction with biological targets. Overall, this compound may be explored for its potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific biological pathways. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₆H₂₂FNO₄S

InChI: InChI=1S/C16H22FNO4S/c1-16(2,3)22-15(19)18-10-4-5-14(11-18)23(20,21)13-8-6-12(17)7-9-13/h6-9,14H,4-5,10-11H2,1-3H3

InChI key: InChIKey=BXLYXLSDBIYVET-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1CN(C(OC(C)(C)C)=O)CCC1)C2=CC=C(F)C=C2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-[(4-fluorophenyl)sulfonyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-[(4-fluorophenyl)sulfonyl]-1-piperidinecarboxylate

1-Piperidinecarboxylicacid, 3-[(4-fluorophenyl)sulfonyl]-, 1,1-dimethylethyl ester

CAS: 887590-22-9

Formula: C₁₆H₂₂FNO₄S

Molecular weight: 343.4136

Ref: IN-DA004DEI