CAS 887590-30-9
:3,4-dihydro-6-methoxy-1(2H)-Quinoxalinecarboxylic acid, t-Butyl ester
Description:
3,4-Dihydro-6-methoxy-1(2H)-quinoxalinecarboxylic acid, t-butyl ester, is a chemical compound characterized by its quinoxaline structure, which is a bicyclic compound containing two nitrogen atoms. This substance features a methoxy group (-OCH3) and a t-butyl ester functional group, contributing to its solubility and reactivity. The presence of the carboxylic acid moiety indicates potential for various chemical reactions, such as esterification and amidation. The compound is likely to exhibit moderate polarity due to the combination of hydrophobic t-butyl and hydrophilic carboxylic acid functionalities. It may also possess biological activity, making it of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C14H20N2O3
InChI:InChI=1S/C14H20N2O3/c1-14(2,3)19-13(17)16-8-7-15-11-9-10(18-4)5-6-12(11)16/h5-6,9,15H,7-8H2,1-4H3
SMILES:CC(C)(C)OC(=O)N1CCNc2cc(ccc12)OC
Synonyms:- 1(2H)-Quinoxalinecarboxylic acid, 3,4-dihydro-6-methoxy-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 6-methoxy-3,4-dihydroquinoxaline-1(2H)-carboxylate
CAS:Formula:C14H20N2O3Molecular weight:264.3202
