CymitQuimica logo

CAS 887590-86-5

:

3-[4-(Phenylmethyl)phenoxy]benzenamine

Description:
3-[4-(Phenylmethyl)phenoxy]benzenamine, with the CAS number 887590-86-5, is an organic compound characterized by its complex aromatic structure. This substance features a central benzenamine moiety, which is an aniline derivative, indicating the presence of an amino group (-NH2) attached to a benzene ring. The compound also contains a phenoxy group, where a phenyl ring is connected via an ether linkage to another phenyl group that has a phenylmethyl substituent. This arrangement contributes to its potential as a ligand in various chemical reactions or as a building block in organic synthesis. The presence of multiple aromatic rings suggests that the compound may exhibit significant stability and hydrophobic characteristics. Additionally, the functional groups present may impart specific reactivity, making it of interest in medicinal chemistry and materials science. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound's unique structure positions it as a candidate for further research in various chemical applications.
Formula:C19H17NO
InChI:InChI=1S/C19H17NO/c20-17-7-4-8-19(14-17)21-18-11-9-16(10-12-18)13-15-5-2-1-3-6-15/h1-12,14H,13,20H2
InChI key:InChIKey=HFCQTCYTTDNUAR-UHFFFAOYSA-N
SMILES:O(C1=CC=C(CC2=CC=CC=C2)C=C1)C3=CC(N)=CC=C3
Synonyms:
  • Benzenamine, 3-[4-(phenylmethyl)phenoxy]-
  • 3-[4-(Phenylmethyl)phenoxy]benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.