CymitQuimica logo

CAS 887591-10-8

:

1-Amino-3-pyrrolidinol

Description:
1-Amino-3-pyrrolidinol is an organic compound characterized by its pyrrolidine ring structure, which features an amino group and a hydroxyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and polar organic solvents, making it versatile for various chemical applications. The presence of both an amino and a hydroxyl group allows for potential reactivity in organic synthesis, particularly in the formation of amides, esters, and other derivatives. 1-Amino-3-pyrrolidinol can serve as a building block in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to participate in nucleophilic reactions. Additionally, it may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, 1-Amino-3-pyrrolidinol is a valuable compound in the field of organic chemistry and medicinal chemistry.
Formula:C4H10N2O
InChI:InChI=1S/C4H10N2O/c5-6-2-1-4(7)3-6/h4,7H,1-3,5H2
InChI key:InChIKey=BXAIQPPVOCFPQA-UHFFFAOYSA-N
SMILES:OC1CN(N)CC1
Synonyms:
  • 3-Pyrrolidinol, 1-amino-
  • 1-Amino-3-pyrrolidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.