
CAS 887591-13-1
:3-Methoxy-1-pyrrolidinamine
Description:
3-Methoxy-1-pyrrolidinamine, identified by its CAS number 887591-13-1, is an organic compound characterized by a pyrrolidine ring substituted with a methoxy group and an amine functional group. This compound typically exhibits properties associated with both amines and ethers, such as basicity and potential nucleophilicity due to the presence of the amine group. The methoxy group can influence the compound's solubility, making it more polar and potentially enhancing its interaction with various solvents. Additionally, the presence of the pyrrolidine ring suggests that it may exhibit cyclic behavior, which can affect its reactivity and stability. 3-Methoxy-1-pyrrolidinamine may be of interest in medicinal chemistry due to its structural features, which could contribute to biological activity. Its synthesis and application in pharmaceuticals or as a building block in organic synthesis may also be explored, although specific applications would depend on further research into its properties and interactions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C5H12N2O
InChI:InChI=1S/C5H12N2O/c1-8-5-2-3-7(6)4-5/h5H,2-4,6H2,1H3
InChI key:InChIKey=LEGLCGJGHWSXDJ-UHFFFAOYSA-N
SMILES:O(C)C1CN(N)CC1
Synonyms:- 1-Amino-3-methoxypyrrolidine
- 1-Pyrrolidinamine, 3-methoxy-
- 3-Methoxy-pyrrolidin-1-ylamine
- 3-Methoxy-1-pyrrolidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
