CAS 887591-41-5

7-Chloro-1H-indole-5-carboxylic acid

Description:

7-Chloro-1H-indole-5-carboxylic acid is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 7-position and a carboxylic acid group at the 5-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for carboxylic acids. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development, particularly for its potential as a scaffold in the synthesis of bioactive molecules. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Additionally, the presence of the chlorine atom can influence its electronic properties and reactivity, making it a valuable compound for further research in organic synthesis and pharmacology.

Formula: C₉H₆ClNO₂

InChI: InChI=1S/C9H6ClNO2/c10-7-4-6(9(12)13)3-5-1-2-11-8(5)7/h1-4,11H,(H,12,13)

InChI key: InChIKey=XGPJDPNLYSERAL-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(C(O)=O)=C1)C=CN2

Synonyms:

• 1H-Indole-5-carboxylic acid, 7-chloro-
• 7-Chloro-1H-indole-5-carboxylic acid

7-Chloro-1H-indole-5-carboxylic acid

CAS: 887591-41-5

7-Chloro-1H-indole-5-carboxylic acid

Purity: 95%

Molecular weight: 195.6g/mol

Ref: 54-OR1045394