CAS 887591-50-6

Ethyl 7-fluoro-1H-indole-5-carboxylate

Description:

Ethyl 7-fluoro-1H-indole-5-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluoro group at the 7-position of the indole ring enhances its reactivity and can influence its biological activity. The carboxylate functional group, esterified with an ethyl group, contributes to its solubility and reactivity, making it a useful intermediate in organic synthesis. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the indole moiety's prevalence in biologically active compounds. Its molecular structure allows for various chemical modifications, which can lead to derivatives with enhanced properties. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine atom, which can affect electronic properties and steric hindrance. Overall, Ethyl 7-fluoro-1H-indole-5-carboxylate is a versatile compound with significant implications in chemical research and drug development.

Formula: C₁₁H₁₀FNO₂

InChI: InChI=1S/C11H10FNO2/c1-2-15-11(14)8-5-7-3-4-13-10(7)9(12)6-8/h3-6,13H,2H2,1H3

InChI key: InChIKey=GBMXTRSYFYPZHE-UHFFFAOYSA-N

SMILES: FC1=C2C(=CC(C(OCC)=O)=C1)C=CN2

Synonyms:

• Ethyl 7-fluoro-1H-indole-5-carboxylate
• 1H-Indole-5-carboxylic acid, 7-fluoro-, ethyl ester