
CAS 887591-60-8
:1,1-Dimethylethyl 3-[[(2-methoxypropyl)amino]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 3-[[(2-methoxypropyl)amino]methyl]-1-pyrrolidinecarboxylate, with CAS number 887591-60-8, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and various functional groups. This compound features a tert-butyl group, which contributes to its steric bulk, and a methoxypropyl moiety that enhances its solubility and potential reactivity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its interactions in biological systems. Additionally, the carboxylate functionality indicates that it can exist in both protonated and deprotonated forms, depending on the pH of the environment. This compound may exhibit properties typical of both amines and esters, making it of interest in medicinal chemistry and drug design. Its specific applications and biological activity would depend on further studies, including its pharmacokinetics and mechanism of action in relevant biological systems. Overall, the unique combination of structural features makes it a candidate for various chemical and pharmaceutical applications.
Formula:C14H28N2O3
InChI:InChI=1S/C14H28N2O3/c1-11(18-5)8-15-9-12-6-7-16(10-12)13(17)19-14(2,3)4/h11-12,15H,6-10H2,1-5H3
InChI key:InChIKey=HCUGBUFSXPXVQD-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(CNCC(OC)C)CC1
Synonyms:- 1,1-Dimethylethyl 3-[[(2-methoxypropyl)amino]methyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 3-[[(2-methoxypropyl)amino]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1-Dimethylethyl 3-[[(2-methoxypropyl)amino]methyl]-1-pyrrolidinecarboxylate
CAS:Formula:C14H28N2O3Molecular weight:272.3837
