CAS 887591-67-5
:3-(2-Nitrophenyl)-5-isoxazolamine
Description:
3-(2-Nitrophenyl)-5-isoxazolamine is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of a nitrophenyl group indicates that there is a nitro group (-NO2) attached to a phenyl ring, which can influence the compound's reactivity and polarity. This compound is typically used in research and may exhibit biological activity, potentially serving as a lead compound in drug development or as a tool in biochemical studies. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the nitro group. Additionally, the isoxazole moiety can contribute to the compound's ability to form hydrogen bonds, affecting its solubility and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, as it may possess toxicological properties.
Formula:C9H7N3O3
InChI:InChI=1S/C9H7N3O3/c10-9-5-7(11-15-9)6-3-1-2-4-8(6)12(13)14/h1-5H,10H2
InChI key:InChIKey=ATHKBNBCSNXZHX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC=C1)C2=NOC(N)=C2
Synonyms:- 5-Isoxazolamine, 3-(2-nitrophenyl)-
- 3-(2-Nitrophenyl)-5-isoxazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
