CymitQuimica logo

CAS 887592-13-4

:

3-(2-Methoxy-1-naphthalenyl)azetidine

Description:
3-(2-Methoxy-1-naphthalenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 2-methoxy-1-naphthalenyl group indicates that the compound has a naphthalene moiety substituted with a methoxy group, contributing to its aromatic characteristics and potentially influencing its reactivity and solubility. This compound may exhibit interesting biological activities due to the combination of the azetidine ring and the aromatic system, which can participate in various chemical interactions. The methoxy group can enhance lipophilicity, affecting the compound's pharmacokinetics and interaction with biological targets. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, its properties such as melting point, boiling point, and solubility would depend on the specific molecular interactions and the environment in which it is studied.
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c1-16-13-7-6-10-4-2-3-5-12(10)14(13)11-8-15-9-11/h2-7,11,15H,8-9H2,1H3
InChI key:InChIKey=OWCOGXBENMCVNG-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=C(C=C1)C=CC=C2)C3CNC3
Synonyms:
  • Azetidine, 3-(2-methoxy-1-naphthalenyl)-
  • 3-(2-Methoxy-1-naphthalenyl)azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.