CAS 887592-30-5

[(5-Methyl-2-thienyl)methyl]hydrazine

Description:

[(5-Methyl-2-thienyl)methyl]hydrazine is an organic compound characterized by its hydrazine functional group, which is known for its reactivity and ability to form various derivatives. The presence of the 5-methyl-2-thienyl moiety indicates that the compound contains a thiazole ring, contributing to its unique chemical properties and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may exhibit moderate to high solubility in polar organic solvents, while its hydrazine group can participate in various chemical reactions, including oxidation and condensation. Due to the presence of both the hydrazine and thienyl groups, this compound may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, it is essential to handle it with care, as hydrazines are often toxic and can pose health risks. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₆H₁₀N₂S

InChI: InChI=1S/C6H10N2S/c1-5-2-3-6(9-5)4-8-7/h2-3,8H,4,7H2,1H3

InChI key: InChIKey=RFKQIUGRQNLNSC-UHFFFAOYSA-N

SMILES: C(NN)C=1SC(C)=CC1

Synonyms:

• [(5-Methyl-2-thienyl)methyl]hydrazine
• Hydrazine, [(5-methyl-2-thienyl)methyl]-

[(5-methylthiophen-2-yl)methyl]hydrazine

CAS: 887592-30-5

Formula: C₆H₁₀N₂S

Molecular weight: 142.222

Ref: IN-DA004BIX