CymitQuimica logo

CAS 887592-33-8

:

[(3-Methyl-2-thienyl)methyl]hydrazine

Description:
[(3-Methyl-2-thienyl)methyl]hydrazine is an organic compound characterized by its unique structure, which includes a thienyl group and a hydrazine functional group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry and as a building block in the synthesis of various pharmaceuticals. The presence of the hydrazine group suggests that it may exhibit biological activity, including potential antitumor or antimicrobial properties. However, due to the presence of nitrogen and sulfur in its structure, it may also pose certain hazards, such as toxicity or reactivity with other chemical agents. Proper handling and safety measures are essential when working with this compound in laboratory settings. As with many organic compounds, its solubility, stability, and reactivity can vary significantly based on environmental conditions and the presence of other substances.
Formula:C6H10N2S
InChI:InChI=1S/C6H10N2S/c1-5-2-3-9-6(5)4-8-7/h2-3,8H,4,7H2,1H3
InChI key:InChIKey=DIQDUQTUAOQKQC-UHFFFAOYSA-N
SMILES:C(NN)C1=C(C)C=CS1
Synonyms:
  • [(3-Methyl-2-thienyl)methyl]hydrazine
  • Hydrazine, [(3-methyl-2-thienyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.