CAS 887592-51-0
:(3-methylimidazol-4-yl)methylhydrazine
Description:
(3-Methylimidazol-4-yl)methylhydrazine is an organic compound characterized by its unique structure, which includes a hydrazine functional group and an imidazole ring. This compound features a methyl group attached to the imidazole ring, contributing to its chemical properties and reactivity. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The presence of both the hydrazine and imidazole moieties suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their biological activity. The compound may exhibit properties such as moderate solubility in polar solvents and potential reactivity with electrophiles, making it a candidate for various chemical reactions. Additionally, safety considerations are essential, as hydrazine derivatives can be toxic and potentially carcinogenic. Proper handling and storage conditions are necessary to mitigate risks associated with exposure. Overall, (3-methylimidazol-4-yl)methylhydrazine is a compound of interest in both research and industrial applications, warranting further investigation into its properties and uses.
Formula:C5H10N4
InChI:InChI=1/C5H10N4/c1-9-4-7-2-5(9)3-8-6/h2,4,8H,3,6H2,1H3
SMILES:Cn1cncc1CNN
Synonyms:- 1H-imidazole, 5-(hydrazinylmethyl)-1-methyl-
- 5-(Hydrazinomethyl)-1-methyl-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
